C23H27N3O3 — CID 135726406
2-(3,5-dimethylphenoxy)-N-(2-hydroxy-1-pentylindol-3-yl)iminoacetamide (PubChem CID 135726406) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-(2-hydroxy-1-pentylindol-3-yl)iminoacetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-(2-hydroxy-1-pentylindol-3-yl)iminoacetamide |
|---|---|
| PubChem CID | 135726406 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-(2-hydroxy-1-pentylindol-3-yl)iminoacetamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)COc2cc(C)cc(C)c2)c2ccccc21 |
| InChI | InChI=1S/C23H27N3O3/c1-4-5-8-11-26-20-10-7-6-9-19(20)22(23(26)28)25-24-21(27)15-29-18-13-16(2)12-17(3)14-18/h6-7,9-10,12-14,28H,4-5,8,11,15H2,1-3H3/b25-24+ |
| InChIKey | UXUZGEMTIIDBQN-OCOZRVBESA-N |
| XLogP | 5.84 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|