C21H22BrN3O3 — CID 135604167
N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-phenoxyacetamide (PubChem CID 135604167) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-phenoxyacetamide.
| Compound Name | N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-phenoxyacetamide |
|---|---|
| PubChem CID | 135604167 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-(5-bromo-2-hydroxy-1-pentylindol-3-yl)imino-2-phenoxyacetamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)COc2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H22BrN3O3/c1-2-3-7-12-25-18-11-10-15(22)13-17(18)20(21(25)27)24-23-19(26)14-28-16-8-5-4-6-9-16/h4-6,8-11,13,27H,2-3,7,12,14H2,1H3/b24-23+ |
| InChIKey | BBLUXIHLBYOPTK-WCWDXBQESA-N |
| XLogP | 5.99 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|