C32H40N6O4 — CID 4502441
N,N'-bis[(2-hydroxy-5-methyl-1-pentylindol-3-yl)imino]butanediamide (PubChem CID 4502441) has the molecular formula C32H40N6O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is N,N'-bis[(2-hydroxy-5-methyl-1-pentylindol-3-yl)imino]butanediamide.
| Compound Name | N,N'-bis[(2-hydroxy-5-methyl-1-pentylindol-3-yl)imino]butanediamide |
|---|---|
| PubChem CID | 4502441 |
| Molecular Formula | C32H40N6O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | N,N'-bis[(2-hydroxy-5-methyl-1-pentylindol-3-yl)imino]butanediamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)CCC(=O)/N=N/c2c(O)n(CCCCC)c3ccc(C)cc23)c2cc(C)ccc21 |
| InChI | InChI=1S/C32H40N6O4/c1-5-7-9-17-37-25-13-11-21(3)19-23(25)29(31(37)41)35-33-27(39)15-16-28(40)34-36-30-24-20-22(4)12-14-26(24)38(32(30)42)18-10-8-6-2/h11-14,19-20,41-42H,5-10,15-18H2,1-4H3/b35-33+,36-34+ |
| InChIKey | QBHAMIIUGWISGL-LBYUQGKWSA-N |
| XLogP | 8.71 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|