C24H27BrN4O3 — CID 4502816
2-bromo-N-[3-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-3-oxopropyl]benzamide (PubChem CID 4502816) has the molecular formula C24H27BrN4O3 and a molecular weight of 499.41 g/mol. Its IUPAC name is 2-bromo-N-[3-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-3-oxopropyl]benzamide.
| Compound Name | 2-bromo-N-[3-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 4502816 |
| Molecular Formula | C24H27BrN4O3 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 2-bromo-N-[3-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-3-oxopropyl]benzamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)CCNC(=O)c2ccccc2Br)c2cc(C)ccc21 |
| InChI | InChI=1S/C24H27BrN4O3/c1-3-4-7-14-29-20-11-10-16(2)15-18(20)22(24(29)32)28-27-21(30)12-13-26-23(31)17-8-5-6-9-19(17)25/h5-6,8-11,15,32H,3-4,7,12-14H2,1-2H3,(H,26,31)/b28-27+ |
| InChIKey | AYVCSSCXZUBORR-BYYHNAKLSA-N |
| XLogP | 6.04 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|