C19H19N3O2 — CID 4501413
N-(2-hydroxy-5-methyl-1-propylindol-3-yl)iminobenzamide (PubChem CID 4501413) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(2-hydroxy-5-methyl-1-propylindol-3-yl)iminobenzamide.
| Compound Name | N-(2-hydroxy-5-methyl-1-propylindol-3-yl)iminobenzamide |
|---|---|
| PubChem CID | 4501413 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(2-hydroxy-5-methyl-1-propylindol-3-yl)iminobenzamide |
| SMILES | CCCn1c(O)c(/N=N/C(=O)c2ccccc2)c2cc(C)ccc21 |
| InChI | InChI=1S/C19H19N3O2/c1-3-11-22-16-10-9-13(2)12-15(16)17(19(22)24)20-21-18(23)14-7-5-4-6-8-14/h4-10,12,24H,3,11H2,1-2H3/b21-20+ |
| InChIKey | CSOPVMZMXLOGHD-QZQOTICOSA-N |
| XLogP | 4.99 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|