C27H33BrN4O3 — CID 4502815
2-bromo-N-[6-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-6-oxohexyl]benzamide (PubChem CID 4502815) has the molecular formula C27H33BrN4O3 and a molecular weight of 541.49 g/mol. Its IUPAC name is 2-bromo-N-[6-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-6-oxohexyl]benzamide.
| Compound Name | 2-bromo-N-[6-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 4502815 |
| Molecular Formula | C27H33BrN4O3 |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2-bromo-N-[6-[(2-hydroxy-5-methyl-1-pentylindol-3-yl)diazenyl]-6-oxohexyl]benzamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)CCCCCNC(=O)c2ccccc2Br)c2cc(C)ccc21 |
| InChI | InChI=1S/C27H33BrN4O3/c1-3-4-10-17-32-23-15-14-19(2)18-21(23)25(27(32)35)31-30-24(33)13-6-5-9-16-29-26(34)20-11-7-8-12-22(20)28/h7-8,11-12,14-15,18,35H,3-6,9-10,13,16-17H2,1-2H3,(H,29,34)/b31-30+ |
| InChIKey | QSNSBOOBHSPHQZ-NVQSTNCTSA-N |
| XLogP | 7.21 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|