C25H30N4O3 — CID 4501227
N-[6-[(2-hydroxy-5-methyl-1-propan-2-ylindol-3-yl)diazenyl]-6-oxohexyl]benzamide (PubChem CID 4501227) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[6-[(2-hydroxy-5-methyl-1-propan-2-ylindol-3-yl)diazenyl]-6-oxohexyl]benzamide.
| Compound Name | N-[6-[(2-hydroxy-5-methyl-1-propan-2-ylindol-3-yl)diazenyl]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 4501227 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[6-[(2-hydroxy-5-methyl-1-propan-2-ylindol-3-yl)diazenyl]-6-oxohexyl]benzamide |
| SMILES | Cc1ccc2c(c1)c(/N=N/C(=O)CCCCCNC(=O)c1ccccc1)c(O)n2C(C)C |
| InChI | InChI=1S/C25H30N4O3/c1-17(2)29-21-14-13-18(3)16-20(21)23(25(29)32)28-27-22(30)12-8-5-9-15-26-24(31)19-10-6-4-7-11-19/h4,6-7,10-11,13-14,16-17,32H,5,8-9,12,15H2,1-3H3,(H,26,31)/b28-27+ |
| InChIKey | GJOBADIXPPLGTH-BYYHNAKLSA-N |
| XLogP | 5.84 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|