C22H24N4O3 — CID 135574739
N'-(2-hydroxy-1-pentylindol-3-yl)imino-N-(4-methylphenyl)oxamide (PubChem CID 135574739) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N'-(2-hydroxy-1-pentylindol-3-yl)imino-N-(4-methylphenyl)oxamide.
| Compound Name | N'-(2-hydroxy-1-pentylindol-3-yl)imino-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 135574739 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N'-(2-hydroxy-1-pentylindol-3-yl)imino-N-(4-methylphenyl)oxamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)C(=O)Nc2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O3/c1-3-4-7-14-26-18-9-6-5-8-17(18)19(22(26)29)24-25-21(28)20(27)23-16-12-10-15(2)11-13-16/h5-6,8-13,29H,3-4,7,14H2,1-2H3,(H,23,27)/b25-24+ |
| InChIKey | HFNYZMYFEQRFGL-OCOZRVBESA-N |
| XLogP | 5.09 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|