C25H20BrN5O4 — CID 4652493
N'-[1-(2-anilino-2-oxoethyl)-5-bromo-2-hydroxyindol-3-yl]imino-N-(4-methylphenyl)oxamide (PubChem CID 4652493) has the molecular formula C25H20BrN5O4 and a molecular weight of 534.37 g/mol. Its IUPAC name is N'-[1-(2-anilino-2-oxoethyl)-5-bromo-2-hydroxyindol-3-yl]imino-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[1-(2-anilino-2-oxoethyl)-5-bromo-2-hydroxyindol-3-yl]imino-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 4652493 |
| Molecular Formula | C25H20BrN5O4 |
| Molecular Weight | 534.37 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | N'-[1-(2-anilino-2-oxoethyl)-5-bromo-2-hydroxyindol-3-yl]imino-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)/N=N/c2c(O)n(CC(=O)Nc3ccccc3)c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C25H20BrN5O4/c1-15-7-10-18(11-8-15)28-23(33)24(34)30-29-22-19-13-16(26)9-12-20(19)31(25(22)35)14-21(32)27-17-5-3-2-4-6-17/h2-13,35H,14H2,1H3,(H,27,32)(H,28,33)/b30-29+ |
| InChIKey | QQWXWLNOUVKVRZ-QVIHXGFCSA-N |
| XLogP | 5.31 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|