C21H21N5O4 — CID 3838815
N'-[2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-N-phenyloxamide (PubChem CID 3838815) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is N'-[2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-N-phenyloxamide.
| Compound Name | N'-[2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-N-phenyloxamide |
|---|---|
| PubChem CID | 3838815 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N'-[2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-N-phenyloxamide |
| SMILES | O=C(/N=N/c1c(O)n(CN2CCOCC2)c2ccccc12)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H21N5O4/c27-19(22-15-6-2-1-3-7-15)20(28)24-23-18-16-8-4-5-9-17(16)26(21(18)29)14-25-10-12-30-13-11-25/h1-9,29H,10-14H2,(H,22,27)/b24-23+ |
| InChIKey | YJASFRAQUWDCFE-WCWDXBQESA-N |
| XLogP | 2.89 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|