C20H19F2N5O2S — CID 135950051
1-[5-fluoro-2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-3-(4-fluorophenyl)thiourea (PubChem CID 135950051) has the molecular formula C20H19F2N5O2S and a molecular weight of 431.47 g/mol. Its IUPAC name is 1-[5-fluoro-2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[5-fluoro-2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 135950051 |
| Molecular Formula | C20H19F2N5O2S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 1-[5-fluoro-2-hydroxy-1-(morpholin-4-ylmethyl)indol-3-yl]imino-3-(4-fluorophenyl)thiourea |
| SMILES | Oc1c(/N=N/C(=S)Nc2ccc(F)cc2)c2cc(F)ccc2n1CN1CCOCC1 |
| InChI | InChI=1S/C20H19F2N5O2S/c21-13-1-4-15(5-2-13)23-20(30)25-24-18-16-11-14(22)3-6-17(16)27(19(18)28)12-26-7-9-29-10-8-26/h1-6,11,28H,7-10,12H2,(H,23,30)/b25-24+ |
| InChIKey | LJRJOQWVQQBOLB-OCOZRVBESA-N |
| XLogP | 4.40 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|