C18H19N5O4S2 — CID 137197131
1-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea (PubChem CID 137197131) has the molecular formula C18H19N5O4S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137197131 |
| Molecular Formula | C18H19N5O4S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-(1-ethyl-2-hydroxy-5-methoxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CCn1c(O)c(/N=N/C(=S)Nc2ccc(S(N)(=O)=O)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C18H19N5O4S2/c1-3-23-15-9-6-12(27-2)10-14(15)16(17(23)24)21-22-18(28)20-11-4-7-13(8-5-11)29(19,25)26/h4-10,24H,3H2,1-2H3,(H,20,28)(H2,19,25,26)/b22-21+ |
| InChIKey | BLTABYDMLRKNMT-QURGRASLSA-N |
| XLogP | 3.50 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|