C17H17N5O4S2 — CID 137196945
1-(2-hydroxy-5-methoxy-1-methylindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea (PubChem CID 137196945) has the molecular formula C17H17N5O4S2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-(2-hydroxy-5-methoxy-1-methylindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(2-hydroxy-5-methoxy-1-methylindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196945 |
| Molecular Formula | C17H17N5O4S2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1-(2-hydroxy-5-methoxy-1-methylindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea |
| SMILES | COc1ccc2c(c1)c(/N=N/C(=S)Nc1ccc(S(N)(=O)=O)cc1)c(O)n2C |
| InChI | InChI=1S/C17H17N5O4S2/c1-22-14-8-5-11(26-2)9-13(14)15(16(22)23)20-21-17(27)19-10-3-6-12(7-4-10)28(18,24)25/h3-9,23H,1-2H3,(H,19,27)(H2,18,24,25)/b21-20+ |
| InChIKey | XIHRGQMUWUKFST-QZQOTICOSA-N |
| XLogP | 3.02 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|