C29H27N5O3S2 — CID 137197069
1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-propan-2-ylindol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea (PubChem CID 137197069) has the molecular formula C29H27N5O3S2 and a molecular weight of 557.70 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-propan-2-ylindol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-propan-2-ylindol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137197069 |
| Molecular Formula | C29H27N5O3S2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-propan-2-ylindol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CC(C)c1ccc2c(c1)c(/N=N/C(=S)Nc1ccc(S(N)(=O)=O)cc1)c(O)n2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H27N5O3S2/c1-18(2)21-9-14-26-25(16-21)27(32-33-29(38)31-23-10-12-24(13-11-23)39(30,36)37)28(35)34(26)17-19-7-8-20-5-3-4-6-22(20)15-19/h3-16,18,35H,17H2,1-2H3,(H,31,38)(H2,30,36,37)/b33-32+ |
| InChIKey | MXAUQQKMQDJISF-ULIFNZDWSA-N |
| XLogP | 6.80 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|