C18H16N6O3S2 — CID 137197043
1-(5-cyano-1-ethyl-2-hydroxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea (PubChem CID 137197043) has the molecular formula C18H16N6O3S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-(5-cyano-1-ethyl-2-hydroxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(5-cyano-1-ethyl-2-hydroxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137197043 |
| Molecular Formula | C18H16N6O3S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-(5-cyano-1-ethyl-2-hydroxyindol-3-yl)imino-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CCn1c(O)c(/N=N/C(=S)Nc2ccc(S(N)(=O)=O)cc2)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C18H16N6O3S2/c1-2-24-15-8-3-11(10-19)9-14(15)16(17(24)25)22-23-18(28)21-12-4-6-13(7-5-12)29(20,26)27/h3-9,25H,2H2,1H3,(H,21,28)(H2,20,26,27)/b23-22+ |
| InChIKey | GIQGOEWDDPKYBB-GHVJWSGMSA-N |
| XLogP | 3.37 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|