C27H20F3N5O4S2 — CID 137196910
1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-(trifluoromethoxy)indol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea (PubChem CID 137196910) has the molecular formula C27H20F3N5O4S2 and a molecular weight of 599.62 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-(trifluoromethoxy)indol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-(trifluoromethoxy)indol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196910 |
| Molecular Formula | C27H20F3N5O4S2 |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | 1-[2-hydroxy-1-(naphthalen-2-ylmethyl)-5-(trifluoromethoxy)indol-3-yl]imino-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)/N=N/c2c(O)n(Cc3ccc4ccccc4c3)c3ccc(OC(F)(F)F)cc23)cc1 |
| InChI | InChI=1S/C27H20F3N5O4S2/c28-27(29,30)39-20-9-12-23-22(14-20)24(33-34-26(40)32-19-7-10-21(11-8-19)41(31,37)38)25(36)35(23)15-16-5-6-17-3-1-2-4-18(17)13-16/h1-14,36H,15H2,(H,32,40)(H2,31,37,38)/b34-33+ |
| InChIKey | AWVCZHFAFTUXRB-JEIPZWNWSA-N |
| XLogP | 6.58 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|