C22H17Cl2N5O3S2 — CID 137196870
1-(1-benzyl-5,7-dichloro-2-hydroxyindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea (PubChem CID 137196870) has the molecular formula C22H17Cl2N5O3S2 and a molecular weight of 534.45 g/mol. Its IUPAC name is 1-(1-benzyl-5,7-dichloro-2-hydroxyindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea.
| Compound Name | 1-(1-benzyl-5,7-dichloro-2-hydroxyindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196870 |
| Molecular Formula | C22H17Cl2N5O3S2 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | 1-(1-benzyl-5,7-dichloro-2-hydroxyindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1cccc(NC(=S)/N=N/c2c(O)n(Cc3ccccc3)c3c(Cl)cc(Cl)cc23)c1 |
| InChI | InChI=1S/C22H17Cl2N5O3S2/c23-14-9-17-19(27-28-22(33)26-15-7-4-8-16(11-15)34(25,31)32)21(30)29(20(17)18(24)10-14)12-13-5-2-1-3-6-13/h1-11,30H,12H2,(H,26,33)(H2,25,31,32)/b28-27+ |
| InChIKey | UMDFKAAFHICSOU-BYYHNAKLSA-N |
| XLogP | 5.83 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|