C15H12FN5O3S2 — CID 137196846
1-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(3-sulfamoylphenyl)thiourea (PubChem CID 137196846) has the molecular formula C15H12FN5O3S2 and a molecular weight of 393.43 g/mol. Its IUPAC name is 1-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(3-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(3-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 137196846 |
| Molecular Formula | C15H12FN5O3S2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 1-[(6-fluoro-2-hydroxy-1H-indol-3-yl)imino]-3-(3-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1cccc(NC(=S)/N=N/c2c(O)[nH]c3cc(F)ccc23)c1 |
| InChI | InChI=1S/C15H12FN5O3S2/c16-8-4-5-11-12(6-8)19-14(22)13(11)20-21-15(25)18-9-2-1-3-10(7-9)26(17,23)24/h1-7,19,22H,(H,18,25)(H2,17,23,24)/b21-20+ |
| InChIKey | JLQOCUIWGOEVAR-QZQOTICOSA-N |
| XLogP | 3.14 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|