C17H16N4OS — CID 135571902
1-(3-ethylphenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea (PubChem CID 135571902) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea.
| Compound Name | 1-(3-ethylphenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea |
|---|---|
| PubChem CID | 135571902 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-(3-ethylphenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]thiourea |
| SMILES | CCc1cccc(NC(=S)/N=N/c2c(O)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C17H16N4OS/c1-2-11-6-5-7-12(10-11)18-17(23)21-20-15-13-8-3-4-9-14(13)19-16(15)22/h3-10,19,22H,2H2,1H3,(H,18,23)/b21-20+ |
| InChIKey | BGLFELAEHQRTQH-QZQOTICOSA-N |
| XLogP | 4.92 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|