C15H10F2N4O2 — CID 169273498
1-(3,4-difluorophenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]urea (PubChem CID 169273498) has the molecular formula C15H10F2N4O2 and a molecular weight of 316.27 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]urea |
|---|---|
| PubChem CID | 169273498 |
| Molecular Formula | C15H10F2N4O2 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(2-hydroxy-1H-indol-3-yl)imino]urea |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccccc12)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H10F2N4O2/c16-10-6-5-8(7-11(10)17)18-15(23)21-20-13-9-3-1-2-4-12(9)19-14(13)22/h1-7,19,22H,(H,18,23)/b21-20+ |
| InChIKey | OJJOYXVAHGZHKT-QZQOTICOSA-N |
| XLogP | 4.47 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|