C18H13N5O2S — CID 135936240
1-[(2-hydroxy-1H-indol-3-yl)imino]-3-(4-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 135936240) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is 1-[(2-hydroxy-1H-indol-3-yl)imino]-3-(4-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(2-hydroxy-1H-indol-3-yl)imino]-3-(4-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 135936240 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[(2-hydroxy-1H-indol-3-yl)imino]-3-(4-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccccc12)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H13N5O2S/c24-16-15(12-8-4-5-9-13(12)19-16)22-23-17(25)21-18-20-14(10-26-18)11-6-2-1-3-7-11/h1-10,19,24H,(H,20,21,25)/b23-22+ |
| InChIKey | GUVITGMRIMPNLB-GHVJWSGMSA-N |
| XLogP | 5.31 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|