C22H16N4OS — CID 170913005
(Z)-2-cyano-3-(2-methyl-1H-indol-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170913005) has the molecular formula C22H16N4OS and a molecular weight of 384.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-methyl-1H-indol-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-methyl-1H-indol-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913005 |
| Molecular Formula | C22H16N4OS |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (Z)-2-cyano-3-(2-methyl-1H-indol-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=C(/C#N)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H16N4OS/c1-14-18(17-9-5-6-10-19(17)24-14)11-16(12-23)21(27)26-22-25-20(13-28-22)15-7-3-2-4-8-15/h2-11,13,24H,1H3,(H,25,26,27)/b16-11- |
| InChIKey | BYSDLMSZTKHTNA-WJDWOHSUSA-N |
| XLogP | 5.15 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|