C27H29N3O2S — CID 146190091
(E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 146190091) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146190091 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)C(=O)Nc2nc(-c3ccccc3)cs2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H29N3O2S/c1-26(2,3)20-13-17(14-21(23(20)31)27(4,5)6)12-19(15-28)24(32)30-25-29-22(16-33-25)18-10-8-7-9-11-18/h7-14,16,31H,1-6H3,(H,29,30,32)/b19-12+ |
| InChIKey | VDFQNIJOONXWFJ-XDHOZWIPSA-N |
| XLogP | 6.66 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|