C25H28N2O4 — CID 45465646
4-[[(E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 45465646) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 45465646 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-[[(E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)C(=O)Nc2ccc(C(=O)O)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H28N2O4/c1-24(2,3)19-12-15(13-20(21(19)28)25(4,5)6)11-17(14-26)22(29)27-18-9-7-16(8-10-18)23(30)31/h7-13,28H,1-6H3,(H,27,29)(H,30,31)/b17-11+ |
| InChIKey | PMIQFBAMDRMCID-GZTJUZNOSA-N |
| XLogP | 5.23 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|