C25H27F3N2O2 — CID 10182002
(E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 10182002) has the molecular formula C25H27F3N2O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10182002 |
| Molecular Formula | C25H27F3N2O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (E)-2-cyano-3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)C(=O)Nc2ccc(C(F)(F)F)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H27F3N2O2/c1-23(2,3)19-12-15(13-20(21(19)31)24(4,5)6)11-16(14-29)22(32)30-18-9-7-17(8-10-18)25(26,27)28/h7-13,31H,1-6H3,(H,30,32)/b16-11+ |
| InChIKey | NHBVXCLQYYYKTD-LFIBNONCSA-N |
| XLogP | 6.55 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|