C18H13N3O3S2 — CID 9335195
(E)-2-cyano-N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 9335195) has the molecular formula C18H13N3O3S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9335195 |
| Molecular Formula | C18H13N3O3S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | (E)-2-cyano-N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1/C=C(\C#N)C(=O)Nc1nc(-c2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C18H13N3O3S2/c1-10-4-5-25-16(10)7-12(8-19)17(24)21-18-20-13(9-26-18)11-2-3-14(22)15(23)6-11/h2-7,9,22-23H,1H3,(H,20,21,24)/b12-7+ |
| InChIKey | HZPMDMDAAWGBDU-KPKJPENVSA-N |
| XLogP | 4.14 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|