C23H21N3OS — CID 1186638
(E)-2-cyano-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 1186638) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1186638 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (E)-2-cyano-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)/C(C#N)=C/c3ccc(C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C23H21N3OS/c1-15(2)18-10-6-17(7-11-18)12-20(13-24)22(27)26-23-25-21(14-28-23)19-8-4-16(3)5-9-19/h4-12,14-15H,1-3H3,(H,25,26,27)/b20-12+ |
| InChIKey | UHEQHGSOOXYBBC-UDWIEESQSA-N |
| XLogP | 5.79 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|