C22H24N2O — CID 730579
(E)-2-cyano-N,3-bis(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 730579) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (E)-2-cyano-N,3-bis(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N,3-bis(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 730579 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (E)-2-cyano-N,3-bis(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C(\C#N)C(=O)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O/c1-15(2)18-7-5-17(6-8-18)13-20(14-23)22(25)24-21-11-9-19(10-12-21)16(3)4/h5-13,15-16H,1-4H3,(H,24,25)/b20-13+ |
| InChIKey | AWPJCKPRGQUNDK-DEDYPNTBSA-N |
| XLogP | 5.48 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|