C19H17BrN2O — CID 2790438
N-(3-bromophenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 2790438) has the molecular formula C19H17BrN2O and a molecular weight of 369.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | N-(3-bromophenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2790438 |
| Molecular Formula | C19H17BrN2O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-(3-bromophenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(C=C(C#N)C(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H17BrN2O/c1-13(2)15-8-6-14(7-9-15)10-16(12-21)19(23)22-18-5-3-4-17(20)11-18/h3-11,13H,1-2H3,(H,22,23) |
| InChIKey | HTCYOILXOPNEIP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|