C19H15BrN2O2 — CID 19109254
(Z)-N-(3-bromophenyl)-2-cyano-3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide (PubChem CID 19109254) has the molecular formula C19H15BrN2O2 and a molecular weight of 383.25 g/mol. Its IUPAC name is (Z)-N-(3-bromophenyl)-2-cyano-3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide.
| Compound Name | (Z)-N-(3-bromophenyl)-2-cyano-3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19109254 |
| Molecular Formula | C19H15BrN2O2 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | (Z)-N-(3-bromophenyl)-2-cyano-3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)prop-2-enamide |
| SMILES | CC1Cc2cc(/C=C(/C#N)C(=O)Nc3cccc(Br)c3)ccc2O1 |
| InChI | InChI=1S/C19H15BrN2O2/c1-12-7-14-8-13(5-6-18(14)24-12)9-15(11-21)19(23)22-17-4-2-3-16(20)10-17/h2-6,8-10,12H,7H2,1H3,(H,22,23)/b15-9- |
| InChIKey | LQRYDUXVSPJNKJ-DHDCSXOGSA-N |
| XLogP | 4.32 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|