C20H18N2O3 — CID 2031358
(E)-2-cyano-N-(3-methoxyphenyl)-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enamide (PubChem CID 2031358) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-methoxyphenyl)-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-methoxyphenyl)-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2031358 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (E)-2-cyano-N-(3-methoxyphenyl)-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(C#N)=C/c2ccc3c(c2)C[C@H](C)O3)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-13-8-15-9-14(6-7-19(15)25-13)10-16(12-21)20(23)22-17-4-3-5-18(11-17)24-2/h3-7,9-11,13H,8H2,1-2H3,(H,22,23)/b16-10+/t13-/m0/s1 |
| InChIKey | DSEXMRLNRVGMFB-RKPNYOAGSA-N |
| XLogP | 3.56 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|