C26H31N3O2 — CID 132665472
(Z)-2-cyano-N-(3-methoxyphenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide (PubChem CID 132665472) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-methoxyphenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-methoxyphenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 132665472 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (Z)-2-cyano-N-(3-methoxyphenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(C#N)=C\c2ccc3c(c2)C(C)CC(C)(C)N3C(C)C)c1 |
| InChI | InChI=1S/C26H31N3O2/c1-17(2)29-24-11-10-19(13-23(24)18(3)15-26(29,4)5)12-20(16-27)25(30)28-21-8-7-9-22(14-21)31-6/h7-14,17-18H,15H2,1-6H3,(H,28,30)/b20-12- |
| InChIKey | IGWSWLOZXMCBJB-NDENLUEZSA-N |
| XLogP | 5.74 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|