C25H27Cl2N3O — CID 132675523
(Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide (PubChem CID 132675523) has the molecular formula C25H27Cl2N3O and a molecular weight of 456.42 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 132675523 |
| Molecular Formula | C25H27Cl2N3O |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dichlorophenyl)-3-(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)prop-2-enamide |
| SMILES | CC1CC(C)(C)N(C(C)C)c2ccc(/C=C(/C#N)C(=O)Nc3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C25H27Cl2N3O/c1-15(2)30-23-9-6-17(11-20(23)16(3)13-25(30,4)5)10-18(14-28)24(31)29-19-7-8-21(26)22(27)12-19/h6-12,15-16H,13H2,1-5H3,(H,29,31)/b18-10- |
| InChIKey | CDPBYXUITIGWJH-ZDLGFXPLSA-N |
| XLogP | 7.04 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|