C24H17N3O3 — CID 18863326
(E)-2-cyano-N-(3-methoxyphenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide (PubChem CID 18863326) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-methoxyphenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-methoxyphenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18863326 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (E)-2-cyano-N-(3-methoxyphenyl)-3-(3-phenyl-2,1-benzoxazol-5-yl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(C#N)=C/c2ccc3noc(-c4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C24H17N3O3/c1-29-20-9-5-8-19(14-20)26-24(28)18(15-25)12-16-10-11-22-21(13-16)23(30-27-22)17-6-3-2-4-7-17/h2-14H,1H3,(H,26,28)/b18-12+ |
| InChIKey | JFVWVHLDWVIMBI-LDADJPATSA-N |
| XLogP | 5.05 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|