C18H15BrN2O2 — CID 5244228
N-(3-bromophenyl)-2-cyano-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide (PubChem CID 5244228) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-cyano-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide.
| Compound Name | N-(3-bromophenyl)-2-cyano-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5244228 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-(3-bromophenyl)-2-cyano-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)Nc2cccc(Br)c2)cc(C)c1O |
| InChI | InChI=1S/C18H15BrN2O2/c1-11-6-13(7-12(2)17(11)22)8-14(10-20)18(23)21-16-5-3-4-15(19)9-16/h3-9,22H,1-2H3,(H,21,23) |
| InChIKey | YUWVJFDCVPWOEM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|