C22H21N3O3S — CID 2034470
2-[[(E)-2-cyano-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2034470) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[[(E)-2-cyano-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[(E)-2-cyano-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2034470 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[[(E)-2-cyano-3-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@H]1Cc2cc(/C=C(\C#N)C(=O)Nc3sc4c(c3C(N)=O)CCCC4)ccc2O1 |
| InChI | InChI=1S/C22H21N3O3S/c1-12-8-14-9-13(6-7-17(14)28-12)10-15(11-23)21(27)25-22-19(20(24)26)16-4-2-3-5-18(16)29-22/h6-7,9-10,12H,2-5,8H2,1H3,(H2,24,26)(H,25,27)/b15-10+/t12-/m0/s1 |
| InChIKey | VWXUCNCXBJPTKA-XBUHWIKASA-N |
| XLogP | 3.59 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|