C16H12N2O3 — CID 869414
(Z)-2-cyano-N,3-bis(4-hydroxyphenyl)prop-2-enamide (PubChem CID 869414) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is (Z)-2-cyano-N,3-bis(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N,3-bis(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 869414 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (Z)-2-cyano-N,3-bis(4-hydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(O)cc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H12N2O3/c17-10-12(9-11-1-5-14(19)6-2-11)16(21)18-13-3-7-15(20)8-4-13/h1-9,19-20H,(H,18,21)/b12-9- |
| InChIKey | DHSLACSDHWIVAQ-XFXZXTDPSA-N |
| XLogP | 2.64 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|