C21H17N3O2S — CID 2561259
(Z)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 2561259) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2561259 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (Z)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)/C(C#N)=C\c3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H17N3O2S/c1-2-14-3-7-16(8-4-14)19-13-27-21(23-19)24-20(26)17(12-22)11-15-5-9-18(25)10-6-15/h3-11,13,25H,2H2,1H3,(H,23,24,26)/b17-11- |
| InChIKey | ZZKZXGQAPSCCMQ-BOPFTXTBSA-N |
| XLogP | 4.62 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|