C23H17N5OS — CID 9367126
(E)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 9367126) has the molecular formula C23H17N5OS and a molecular weight of 411.49 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 9367126 |
| Molecular Formula | C23H17N5OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (E)-2-cyano-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)/C(C#N)=C/c3cnc4ccccc4n3)n2)cc1 |
| InChI | InChI=1S/C23H17N5OS/c1-2-15-7-9-16(10-8-15)21-14-30-23(27-21)28-22(29)17(12-24)11-18-13-25-19-5-3-4-6-20(19)26-18/h3-11,13-14H,2H2,1H3,(H,27,28,29)/b17-11+ |
| InChIKey | UDGPAGRQIGMQRO-GZTJUZNOSA-N |
| XLogP | 4.86 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|