C17H11N3O2S — CID 17373427
(Z)-2-cyano-3-(furan-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 17373427) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is (Z)-2-cyano-3-(furan-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(furan-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17373427 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (Z)-2-cyano-3-(furan-3-yl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccoc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H11N3O2S/c18-9-14(8-12-6-7-22-10-12)16(21)20-17-19-15(11-23-17)13-4-2-1-3-5-13/h1-8,10-11H,(H,19,20,21)/b14-8- |
| InChIKey | ZHXTWCQHMNGNHR-ZSOIEALJSA-N |
| XLogP | 3.95 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|