C17H15N5OS — CID 166843790
(2E)-2-cyano-4-(methyliminomethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienamide (PubChem CID 166843790) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is (2E)-2-cyano-4-(methyliminomethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienamide.
| Compound Name | (2E)-2-cyano-4-(methyliminomethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 166843790 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (2E)-2-cyano-4-(methyliminomethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienamide |
| SMILES | C=C(/C=C(\C#N)C(=O)Nc1nc(-c2ccccc2)cs1)N/C=N/C |
| InChI | InChI=1S/C17H15N5OS/c1-12(20-11-19-2)8-14(9-18)16(23)22-17-21-15(10-24-17)13-6-4-3-5-7-13/h3-8,10-11H,1H2,2H3,(H,19,20)(H,21,22,23)/b14-8+ |
| InChIKey | PTHTZTOIEGGQPP-RIYZIHGNSA-N |
| XLogP | 2.96 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|