C20H13N3O3S — CID 162423547
[4-[(E)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]phenyl] formate (PubChem CID 162423547) has the molecular formula C20H13N3O3S and a molecular weight of 375.41 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]phenyl] formate.
| Compound Name | [4-[(E)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]phenyl] formate |
|---|---|
| PubChem CID | 162423547 |
| Molecular Formula | C20H13N3O3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [4-[(E)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]phenyl] formate |
| SMILES | N#C/C(=C\c1ccc(OC=O)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H13N3O3S/c21-11-16(10-14-6-8-17(9-7-14)26-13-24)19(25)23-20-22-18(12-27-20)15-4-2-1-3-5-15/h1-10,12-13H,(H,22,23,25)/b16-10+ |
| InChIKey | ZLOJURXQXRAEOA-MHWRWJLKSA-N |
| XLogP | 3.89 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|