C31H27N3O4S — CID 171331661
2-cyano-3-[4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 171331661) has the molecular formula C31H27N3O4S and a molecular weight of 537.64 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171331661 |
| Molecular Formula | C31H27N3O4S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 2-cyano-3-[4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | C=CCc1ccc(OCCOc2ccc(C=C(C#N)C(=O)Nc3nc(-c4ccccc4)cs3)cc2)c(OC)c1 |
| InChI | InChI=1S/C31H27N3O4S/c1-3-7-22-12-15-28(29(19-22)36-2)38-17-16-37-26-13-10-23(11-14-26)18-25(20-32)30(35)34-31-33-27(21-39-31)24-8-5-4-6-9-24/h3-6,8-15,18-19,21H,1,7,16-17H2,2H3,(H,33,34,35) |
| InChIKey | HCGVEEREOURTDX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|