C24H23N3O2S — CID 19206775
(E)-2-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-propoxyphenyl)prop-2-enamide (PubChem CID 19206775) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19206775 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (E)-2-cyano-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccccc1/C=C(\C#N)C(=O)Nc1nc(-c2ccc(C)c(C)c2)cs1 |
| InChI | InChI=1S/C24H23N3O2S/c1-4-11-29-22-8-6-5-7-19(22)13-20(14-25)23(28)27-24-26-21(15-30-24)18-10-9-16(2)17(3)12-18/h5-10,12-13,15H,4,11H2,1-3H3,(H,26,27,28)/b20-13+ |
| InChIKey | SHDKRFWYLPHRME-DEDYPNTBSA-N |
| XLogP | 5.76 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|