C20H19IN2O2 — CID 19206724
(E)-2-cyano-N-(4-iodo-2-methylphenyl)-3-(2-propoxyphenyl)prop-2-enamide (PubChem CID 19206724) has the molecular formula C20H19IN2O2 and a molecular weight of 446.29 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-iodo-2-methylphenyl)-3-(2-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-iodo-2-methylphenyl)-3-(2-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19206724 |
| Molecular Formula | C20H19IN2O2 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (E)-2-cyano-N-(4-iodo-2-methylphenyl)-3-(2-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccccc1/C=C(\C#N)C(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C20H19IN2O2/c1-3-10-25-19-7-5-4-6-15(19)12-16(13-22)20(24)23-18-9-8-17(21)11-14(18)2/h4-9,11-12H,3,10H2,1-2H3,(H,23,24)/b16-12+ |
| InChIKey | SPZRFRBHYNFEBE-FOWTUZBSSA-N |
| XLogP | 4.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|