C23H26N2O3 — CID 7969308
(E)-2-cyano-N-(2,4-dimethylphenyl)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enamide (PubChem CID 7969308) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dimethylphenyl)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7969308 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dimethylphenyl)-3-(3-ethoxy-2-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1c(/C=C(\C#N)C(=O)Nc2ccc(C)cc2C)cccc1OCC |
| InChI | InChI=1S/C23H26N2O3/c1-5-12-28-22-18(8-7-9-21(22)27-6-2)14-19(15-24)23(26)25-20-11-10-16(3)13-17(20)4/h7-11,13-14H,5-6,12H2,1-4H3,(H,25,26)/b19-14+ |
| InChIKey | IHEYSJXAZBPVRM-XMHGGMMESA-N |
| XLogP | 5.04 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|