C23H26N2O4 — CID 40625864
(E)-2-cyano-3-(2,4-dipropoxyphenyl)-N-(2-methoxyphenyl)prop-2-enamide (PubChem CID 40625864) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,4-dipropoxyphenyl)-N-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,4-dipropoxyphenyl)-N-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 40625864 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (E)-2-cyano-3-(2,4-dipropoxyphenyl)-N-(2-methoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C(\C#N)C(=O)Nc2ccccc2OC)c(OCCC)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-4-12-28-19-11-10-17(22(15-19)29-13-5-2)14-18(16-24)23(26)25-20-8-6-7-9-21(20)27-3/h6-11,14-15H,4-5,12-13H2,1-3H3,(H,25,26)/b18-14+ |
| InChIKey | BGLCJTIALHEINA-NBVRZTHBSA-N |
| XLogP | 4.82 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|