C23H24N2O4 — CID 19206665
propyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19206665) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is propyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | propyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19206665 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | propyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)/C(C#N)=C/c2ccccc2OCCC)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-3-13-28-21-8-6-5-7-18(21)15-19(16-24)22(26)25-20-11-9-17(10-12-20)23(27)29-14-4-2/h5-12,15H,3-4,13-14H2,1-2H3,(H,25,26)/b19-15+ |
| InChIKey | PLDFTDISGBRWFJ-XDJHFCHBSA-N |
| XLogP | 4.59 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|