C26H28N2O4 — CID 19206667
cyclohexyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19206667) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is cyclohexyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19206667 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | cyclohexyl 4-[[(E)-2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCOc1ccccc1/C=C(\C#N)C(=O)Nc1ccc(C(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-2-16-31-24-11-7-6-8-20(24)17-21(18-27)25(29)28-22-14-12-19(13-15-22)26(30)32-23-9-4-3-5-10-23/h6-8,11-15,17,23H,2-5,9-10,16H2,1H3,(H,28,29)/b21-17+ |
| InChIKey | CEQRMBFCWGDHCQ-HEHNFIMWSA-N |
| XLogP | 5.51 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|