C19H14ClN3O — CID 23476794
(Z)-N-(2-chlorophenyl)-2-cyano-3-(2-methyl-1H-indol-3-yl)prop-2-enamide (PubChem CID 23476794) has the molecular formula C19H14ClN3O and a molecular weight of 335.79 g/mol. Its IUPAC name is (Z)-N-(2-chlorophenyl)-2-cyano-3-(2-methyl-1H-indol-3-yl)prop-2-enamide.
| Compound Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-(2-methyl-1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23476794 |
| Molecular Formula | C19H14ClN3O |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (Z)-N-(2-chlorophenyl)-2-cyano-3-(2-methyl-1H-indol-3-yl)prop-2-enamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=C(/C#N)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H14ClN3O/c1-12-15(14-6-2-4-8-17(14)22-12)10-13(11-21)19(24)23-18-9-5-3-7-16(18)20/h2-10,22H,1H3,(H,23,24)/b13-10- |
| InChIKey | AGTJKIVAKQMDNS-RAXLEYEMSA-N |
| XLogP | 4.68 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|